cas: 287966-92-1 — see every product listed under this CAS number, including other names
(S)-3-(Pyrrolidin-2-yl)pyridine dihydrochloride 95% (CAS 287966-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A366183-250mg |
| cas | 287966-92-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A366183 |
3-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride (CAS 287966-92-1) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 3-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride. InChIKey: AOKIOTLTYKVREB-WWPIYYJJSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 3-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride |
| InChIKey | AOKIOTLTYKVREB-WWPIYYJJSA-N |
| SMILES | C1C[C@H](NC1)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)