cas: 748128-13-4 — see every product listed under this CAS number, including other names
(S)-3-AMINO-3-(2,3-DICHLORO-PHENYL)-PROPIONIC ACID, 95%, 95% (CAS 748128-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119OUR-100mg |
| cas | 748128-13-4 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1120.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(2,3-dichlorophenyl)propanoic acid (CAS 748128-13-4) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (3S)-3-amino-3-(2,3-dichlorophenyl)propanoic acid. InChIKey: GQKLESLYMHWBOP-ZETCQYMHSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (3S)-3-amino-3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | GQKLESLYMHWBOP-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)