CAS 1218475-73-0 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-2-(methylamino)acetic acid, 95%, 2-(3,4-Dichlorophenyl)-2-(methylamino)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
2-(3,4-dichlorophenyl)-2-(methylamino)acetic acid (CAS 1218475-73-0) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-(methylamino)acetic acid. InChIKey: GWDRVMZGPSUTQH-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-(methylamino)acetic acid |
| InChIKey | GWDRVMZGPSUTQH-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=C(C=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)