Products 1370592-24-7
CAS 1370592-24-7 is the registry number for 3-Chloro-n-(5-chloro-2-hydroxyphenyl)propanamide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-N-(5-chloro-2-hydroxyphenyl)propanamide (CAS 1370592-24-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 3-chloro-N-(5-chloro-2-hydroxyphenyl)propanamide. InChIKey: QGFTUKNWLUVYMO-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3-chloro-N-(5-chloro-2-hydroxyphenyl)propanamide |
| InChIKey | QGFTUKNWLUVYMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)NC(=O)CCCl)O |
Computed by PubChem (NCBI)