cas: 569660-89-5 — see every product listed under this CAS number, including other names
(S)-3-Bromo-pyrrolidine-1-carboxylic acid tert-butyl ester, 98% (CAS 569660-89-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088273-250MG |
| cas | 569660-89-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Fluorochem | 10g | 3168.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-bromopyrrolidine-1-carboxylate (CAS 569660-89-5) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (3S)-3-bromopyrrolidine-1-carboxylate. InChIKey: QJTKPXFJOXKUEY-ZETCQYMHSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (3S)-3-bromopyrrolidine-1-carboxylate |
| InChIKey | QJTKPXFJOXKUEY-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)Br |
Computed by PubChem (NCBI)