cas: 763139-04-4 — see every product listed under this CAS number, including other names
(S)-4-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 97%, 97% (CAS 763139-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DKOZ-100mg |
| cas | 763139-04-4 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2330.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride (CAS 763139-04-4) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride. InChIKey: YUEKJBCPERBCDN-DDWIOCJRSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride |
| InChIKey | YUEKJBCPERBCDN-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)O.Cl |
Computed by PubChem (NCBI)