CAS 763139-04-4 appears in our catalog under these names: (S)–4–(1–Amino–2–hydroxyethyl)phenol hydrochloride, (S)-4-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 95%, (S)-4-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 97%, 97%, (S)-4-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 97%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride (CAS 763139-04-4) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride. InChIKey: YUEKJBCPERBCDN-DDWIOCJRSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride |
| InChIKey | YUEKJBCPERBCDN-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)O.Cl |
Computed by PubChem (NCBI)