CAS 1242184-45-7 appears in our catalog under these names: Rac-(1r,2s,3r,4s)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid hydrochloride, 95%, (1R,2S,3R,4S)-3-Aminobicyclo(2.2.1)hept-5-ene-2-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride (CAS 1242184-45-7) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride. InChIKey: JZBHUJIMERBHKY-DABREVLYSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride |
| InChIKey | JZBHUJIMERBHKY-DABREVLYSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]([C@H]2C(=O)O)N.Cl |
Computed by PubChem (NCBI)