cas: 3415-08-5 — see every product listed under this CAS number, including other names
(S)-4-(4-Hydroxybenzyl)oxazolidine-2,5-dione, 95% (CAS 3415-08-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235019-1G |
| cas | 3415-08-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 601.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4S)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione (CAS 3415-08-5) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: (4S)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione. InChIKey: HOEAPYNDVBABMC-QMMMGPOBSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | (4S)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione |
| InChIKey | HOEAPYNDVBABMC-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@H]2C(=O)OC(=O)N2)O |
Computed by PubChem (NCBI)