CAS 674304-28-0 appears in our catalog under these names: 4-Methyl-3-oxo-3,4-dihydro-2h-1,4-benzoxazine-7-carboxylic acid, 95%, 4-Methyl-3-oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-7-carboxylic acid, 95+%, 4-Methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 10g.
4-methyl-3-oxo-1,4-benzoxazine-7-carboxylic acid (CAS 674304-28-0) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 4-methyl-3-oxo-1,4-benzoxazine-7-carboxylic acid. InChIKey: DWACAMRHWXPDGA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 4-methyl-3-oxo-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | DWACAMRHWXPDGA-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)