CAS 1195159-84-2 appears in our catalog under these names: 2-Methyl-3-oxo-3,4-dihydro-2h-1,4-benzoxazine-8-carboxylic acid, 95%, 2-Methyl-3-oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-8-carboxylic acid, 97%, 2-Methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-8-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g.
2-methyl-3-oxo-4H-1,4-benzoxazine-8-carboxylic acid (CAS 1195159-84-2) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 2-methyl-3-oxo-4H-1,4-benzoxazine-8-carboxylic acid. InChIKey: CJWMPXSPYXEIOE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 2-methyl-3-oxo-4H-1,4-benzoxazine-8-carboxylic acid |
| InChIKey | CJWMPXSPYXEIOE-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=CC=CC(=C2O1)C(=O)O |
Computed by PubChem (NCBI)