(S)-4-(Amino(carboxy)methyl)benzoic acid hydrochloride, 95%, 95%
cas: 2109874-13-5 — see every product listed under this CAS number, including other names
(S)-4-(Amino(carboxy)methyl)benzoic acid hydrochloride, 95%, 95% (CAS 2109874-13-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU8L-10mg |
| cas | 2109874-13-5 |
| size | 10mg |
| availability | 0.1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 472.40 Pln | |
| Chemat | 25mg | 837.20 Pln | |
| Chemat | 100mg | 1379.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(S)-amino(carboxy)methyl]benzoic acid;hydrochloride (CAS 2109874-13-5) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 4-[(S)-amino(carboxy)methyl]benzoic acid;hydrochloride. InChIKey: CXRMZVRXERFVAG-FJXQXJEOSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 4-[(S)-amino(carboxy)methyl]benzoic acid;hydrochloride |
| InChIKey | CXRMZVRXERFVAG-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-4-(Amino(carboxy)methyl)benzoic acid hydrochloride, 4-[(S)-amino(carboxy)methyl]benzoic acid;hydrochloride, (S)-4-(Amino(carboxy)methyl)benzoic acid HCl, H-Phg(4-COOH)-OH, (S)-4-(Amino(carboxy)methyl)benzoicacidhydrochloride, 4-[(S)-amino(carboxy)methyl]benzoic acid hydrochloride, (S)-4-(Amino(carboxy)methyl)benZoic acid hydrochloride (H-Phg(4-CO2H)-OH.HCl)