cas: 1213519-46-0 — see every product listed under this CAS number, including other names
(S)-4-Fluoro-2,3-dihydrobenzofuran-3-amine 97% (CAS 1213519-46-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816664-50mg |
| cas | 1213519-46-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 325.88 Pln | |
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 820.94 Pln | |
| Ambeed | 1g | 2317.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A816664 |
(3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine (CAS 1213519-46-0) is a chemical compound with the molecular formula C8H8FNO and a molecular weight of 153.15 g/mol. IUPAC name: (3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: AQQJRPFPRCBKNR-ZCFIWIBFSA-N.
| Molecular formula | C8H8FNO |
|---|---|
| Molecular weight | 153.15 g/mol |
| IUPAC name | (3S)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | AQQJRPFPRCBKNR-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)C=CC=C2F)N |
Computed by PubChem (NCBI)