cas: 184346-45-0 — see every product listed under this CAS number, including other names
(S)-4-Isopropyl-5,5-diphenyloxazolidin-2-one, 97%, 97% (CAS 184346-45-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CML-100mg |
| cas | 184346-45-0 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (CAS 184346-45-0) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one. InChIKey: PHTOJBANGYSTOH-INIZCTEOSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (4S)-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| InChIKey | PHTOJBANGYSTOH-INIZCTEOSA-N |
| SMILES | CC(C)[C@H]1C(OC(=O)N1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)