cas: 865303-57-7 — see every product listed under this CAS number, including other names
(S)-5,6,7,8-Tetrahydroquinolin-8-amine dihydrochloride, 97%, 97% (CAS 865303-57-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GU1F-50mg |
| cas | 865303-57-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 198.80 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 981.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(8S)-5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride (CAS 865303-57-7) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: (8S)-5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride. InChIKey: DTETYNWEDVEEFT-JZGIKJSDSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | (8S)-5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride |
| InChIKey | DTETYNWEDVEEFT-JZGIKJSDSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)