cas: 41722-49-0 — see every product listed under this CAS number, including other names
(S)-5,8a-Dimethyl-3,4,8,8a-tetrahydronaphthalene-1,6(2H,7H)-dione 95% (CAS 41722-49-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A484140-25mg |
| cas | 41722-49-0 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 503.88 Pln | |
| Ambeed | 50mg | 804.25 Pln | |
| Ambeed | 100mg | 960.00 Pln | |
| Ambeed | 250mg | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A484140 |
(8aS)-5,8a-dimethyl-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione (CAS 41722-49-0) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: (8aS)-5,8a-dimethyl-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione. InChIKey: YMSJMUXZPBXLSI-LBPRGKRZSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | (8aS)-5,8a-dimethyl-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione |
| InChIKey | YMSJMUXZPBXLSI-LBPRGKRZSA-N |
| SMILES | CC1=C2CCCC(=O)[C@]2(CCC1=O)C |
Computed by PubChem (NCBI)