CAS 4197-75-5 is the registry number for 2-Cyclohexylbenzene-1,4-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
2-cyclohexylbenzene-1,4-diol (CAS 4197-75-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-cyclohexylbenzene-1,4-diol. InChIKey: SNWSZCGYPHRJEY-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-cyclohexylbenzene-1,4-diol |
| InChIKey | SNWSZCGYPHRJEY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)