Products 1147858-85-2

CAS 1147858-85-2 is the registry number for Methyl 2,4-diethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,4-diethylbenzoate (CAS 1147858-85-2) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: methyl 2,4-diethylbenzoate. InChIKey: DWBNOJJRJJVENF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC namemethyl 2,4-diethylbenzoate
InChIKeyDWBNOJJRJJVENF-UHFFFAOYSA-N
SMILESCCC1=CC(=C(C=C1)C(=O)OC)CC

Computed by PubChem (NCBI)