CAS 22146-59-4 appears in our catalog under these names: (2S)-2-Acetamido-3,3-dimethylbutanoic acid, (S)-2-Acetamido-3,3-dimethylbutanoic acid, 97%, 97%, (S)-2-Acetamido-3,3-dimethylbutanoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 15g, 25g, 50g, 75g, 100g.
(2S)-2-acetamido-3,3-dimethylbutanoic acid (CAS 22146-59-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: (2S)-2-acetamido-3,3-dimethylbutanoic acid. InChIKey: WPPXAQGLXQAVTE-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2S)-2-acetamido-3,3-dimethylbutanoic acid |
| InChIKey | WPPXAQGLXQAVTE-ZCFIWIBFSA-N |
| SMILES | CC(=O)N[C@H](C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)