CAS 3120-64-7 appears in our catalog under these names: (2R)-2-Acetamido-3,3-dimethylbutanoic acid, 95%, (2R)-2-Acetamido-3,3-dimethylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(2R)-2-acetamido-3,3-dimethylbutanoic acid (CAS 3120-64-7) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: (2R)-2-acetamido-3,3-dimethylbutanoic acid. InChIKey: WPPXAQGLXQAVTE-LURJTMIESA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2R)-2-acetamido-3,3-dimethylbutanoic acid |
| InChIKey | WPPXAQGLXQAVTE-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)