cas: 405061-52-1 — see every product listed under this CAS number, including other names
(S)-BENZYL 3-(HYDROXYMETHYL)PIPERIDINE-1-CARBOXYLATE, 98% (CAS 405061-52-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331614-250MG |
| cas | 405061-52-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1263.11 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 5063.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (3S)-3-(hydroxymethyl)piperidine-1-carboxylate (CAS 405061-52-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl (3S)-3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: XLWOOUZKMJBINO-ZDUSSCGKSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl (3S)-3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | XLWOOUZKMJBINO-ZDUSSCGKSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)