CAS 98648-05-6 appears in our catalog under these names: Benzyl 6-oxohexylcarbamate, 95%, Benzyl (6-oxohexyl)carbamate, BENZYL 6-OXOHEXYLCARBAMATE, 97%, Benzyl (6-oxohexyl)carbamate, 97%, 97%, benzyl N-(6-oxohexyl)carbamate, 97%. Offered by: Combi-blocks, MedChemExpress, Fluorochem, Chemat, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100 mg, 250 mg, 1 g.
Benzyl N-(6-oxohexyl)carbamate (CAS 98648-05-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl N-(6-oxohexyl)carbamate. InChIKey: XPGMGPSEWHRDSL-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl N-(6-oxohexyl)carbamate |
| InChIKey | XPGMGPSEWHRDSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCC=O |
Computed by PubChem (NCBI)