Products 904797-70-2

CAS 904797-70-2 is the registry number for 4-[(2-Isopropyl-6-methylphenyl)amino]-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-methyl-6-propan-2-ylanilino)-4-oxobutanoic acid (CAS 904797-70-2) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 4-(2-methyl-6-propan-2-ylanilino)-4-oxobutanoic acid. InChIKey: GRCUSKVECIIUGY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3
Molecular weight249.30 g/mol
IUPAC name4-(2-methyl-6-propan-2-ylanilino)-4-oxobutanoic acid
InChIKeyGRCUSKVECIIUGY-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C(C)C)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)