cas: 1033245-45-2 — see every product listed under this CAS number, including other names
(S)-Benzyl (pyrrolidin-2-ylmethyl)carbamate hydrochloride, 95% (CAS 1033245-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692132-100MG |
| cas | 1033245-45-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 716.43 Pln | |
| Fluorochem | 250mg | 1388.07 Pln | |
| Fluorochem | 1g | 3314.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride (CAS 1033245-45-2) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride. InChIKey: AEFMEOUFLZOLHQ-YDALLXLXSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl N-[[(2S)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride |
| InChIKey | AEFMEOUFLZOLHQ-YDALLXLXSA-N |
| SMILES | C1C[C@H](NC1)CNC(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)