cas: 1217720-49-4 — see every product listed under this CAS number, including other names
(S)-Benzyl 2-methylpiperazine-1-carboxylate hydrochloride, 97%, 97% (CAS 1217720-49-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126WW-1g |
| cas | 1217720-49-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 606.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S)-2-methylpiperazine-1-carboxylate;hydrochloride (CAS 1217720-49-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (2S)-2-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: WQPQNIUAWYRGJF-MERQFXBCSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (2S)-2-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | WQPQNIUAWYRGJF-MERQFXBCSA-N |
| SMILES | C[C@H]1CNCCN1C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)