cas: 124391-76-0 — see every product listed under this CAS number, including other names
(S)-Benzyl 3-(hydroxymethyl)pyrrolidine-1-carboxylate, 98%, 98% (CAS 124391-76-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LXQ-10g |
| cas | 124391-76-0 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 890.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 124391-76-0) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: ZRMWRJLLAVAFQP-LBPRGKRZSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | ZRMWRJLLAVAFQP-LBPRGKRZSA-N |
| SMILES | C1CN(C[C@H]1CO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)