cas: 876378-16-4 — see every product listed under this CAS number, including other names
(S)-Benzyl 3-aminopiperidine-1-carboxylate hydrochloride, 97%, 97% (CAS 876378-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEPH-250mg |
| cas | 876378-16-4 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 25g | 1418.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride (CAS 876378-16-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride. InChIKey: ODSBVOIXQVBLEU-YDALLXLXSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride |
| InChIKey | ODSBVOIXQVBLEU-YDALLXLXSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)