CAS 109183-72-4 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–2–cyclopentylacetic acid, (S)-2-((tert-Butoxycarbonyl)amino)-2-cyclopentylacetic acid, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-2-cyclopentylacetic acid, 98.0%, Boc-L-Cyclopentylglycine, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g, 1 g, 10 g.
(2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 109183-72-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: WBSJQVRMQOLSAT-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | WBSJQVRMQOLSAT-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CCCC1)C(=O)O |
Computed by PubChem (NCBI)