cas: 10017-44-4 — see every product listed under this CAS number, including other names
(S)-Carnitine Hydrochloride, ≥98%, ≥98% (CAS 10017-44-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11126N-5mg |
| cas | 10017-44-4 |
| size | 5mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 299.60 Pln | |
| Chemat | 25mg | 674.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
[(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride (CAS 10017-44-4) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: [(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: JXXCENBLGFBQJM-RGMNGODLSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | JXXCENBLGFBQJM-RGMNGODLSA-N |
| SMILES | C[N+](C)(C)C[C@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)