Products 10017-44-4
CAS 10017-44-4 appears in our catalog under these names: D-Carnitine hydrochloride, 95%, D-Carnitine HCl, 98%, D-Carnitine hydrochloride/ 99.67% (existing batch purity), D–Carnitine hydrochloride, (S)-Carnitine Hydrochloride, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 50mg, 200mg, 500mg.
[(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride (CAS 10017-44-4) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: [(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: JXXCENBLGFBQJM-RGMNGODLSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | JXXCENBLGFBQJM-RGMNGODLSA-N |
| SMILES | C[N+](C)(C)C[C@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
D-Carnitine hydrochloride, (+)-Carnitine hydrochloride, (S)-3-Carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride, (S)-Carnitine hydrochloride, [(2S)-3-carboxy-2-hydroxypropyl]-trimethylazanium;chloride, D-Carnitine (hydrochloride), [(2S)-3-carboxy-2-hydroxypropyl]trimethylazanium chloride, D-Carnitine HCl, Carnitine D-form hydrochloride, Ammonium, (3-carboxy-2-hydroxypropyl)trimethyl-, chloride, (+)-