CAS 6645-46-1 appears in our catalog under these names: L-Carnitine hydrochloride, min. 95 %, 1 kg, L-Carnitine hydrochloride, 97%, (R)-3-Carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium Chloride, >95% (HPLC), L-Carnitine hydrochloride, L–Carnitine hydrochloride. Offered by: Roth, Combi-blocks, TRC, TargetMol, GLPBio. Available pack sizes: 1kg, 100g, 25g, 500g, 5g, 250mg, 50mg, 5mg.
[(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride (CAS 6645-46-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: JXXCENBLGFBQJM-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)