cas: 958635-12-6 — see every product listed under this CAS number, including other names
(S)-DI-TERT-BUTYL 2-(HYDROXYMETHYL)PIPERAZINE-1,4-DICARBOXYLATE (CAS 958635-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330970-250MG |
| cas | 958635-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2288.80 Pln | |
| Fluorochem | 500mg | 3267.62 Pln | |
| Fluorochem | 1g | 5501.21 Pln | |
| Fluorochem | 5g | 21115.50 Pln |
| delivery time | 3-4 weeks |
|---|
Ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate (CAS 958635-12-6) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate. InChIKey: TXCFQKQBPSGAKK-NSHDSACASA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | TXCFQKQBPSGAKK-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)