cas: 958635-12-6 — see every product listed under this CAS number, including other names
(S)-Di-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 97%, 97% (CAS 958635-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJHH-250mg |
| cas | 958635-12-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1398.80 Pln | |
| Chemat | 500mg | 1989.20 Pln | |
| Chemat | 1g | 3338.00 Pln | |
| Chemat | 5g | 12760.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate (CAS 958635-12-6) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate. InChIKey: TXCFQKQBPSGAKK-NSHDSACASA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | TXCFQKQBPSGAKK-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)