cas: 1142223-08-2 — see every product listed under this CAS number, including other names
(S)-METHYL 3-CYCLOPROPYL-3-(3-HYDROXYPHENYL)PROPANOATE, 98% (CAS 1142223-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F473416-100MG |
| cas | 1142223-08-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 500mg | 1643.19 Pln | |
| Fluorochem | 1g | 1856.66 Pln | |
| Fluorochem | 5g | 8593.87 Pln | |
| Fluorochem | 10g | 14805.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate (CAS 1142223-08-2) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. InChIKey: PXBFBXFVUPMAJK-LBPRGKRZSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
| InChIKey | PXBFBXFVUPMAJK-LBPRGKRZSA-N |
| SMILES | COC(=O)C[C@@H](C1CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)