cas: 2389-49-3 — see every product listed under this CAS number, including other names
(S)-Methyl 2-(((benzyloxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoate, 98%, 98% (CAS 2389-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C53Q-1g |
| cas | 2389-49-3 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 25g | 914.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (CAS 2389-49-3) is a chemical compound with the molecular formula C20H30N2O6 and a molecular weight of 394.5 g/mol. IUPAC name: methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: ZJWQKFBUQSKZOS-INIZCTEOSA-N.
| Molecular formula | C20H30N2O6 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | ZJWQKFBUQSKZOS-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)