CAS 84559-78-4 appears in our catalog under these names: Z-D-Lys(boc)-ome, 96%, (R)-Methyl 2-(((benzyloxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoate, 96%, Nα-Z-Nε-Boc-D-lysine methyl ester, Z-D-LYS(BOC)-OME, 98%, 98%, Nα-Z-Nε-Boc-D-lysine methyl ester, min. 95 %, 500 mg. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Roth. Available pack sizes: 25g, 1g, 5g, 10g, 500mg, 1000mg, 2000mg, 5000mg.
Methyl (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (CAS 84559-78-4) is a chemical compound with the molecular formula C20H30N2O6 and a molecular weight of 394.5 g/mol. IUPAC name: methyl (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: ZJWQKFBUQSKZOS-MRXNPFEDSA-N.
| Molecular formula | C20H30N2O6 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | methyl (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | ZJWQKFBUQSKZOS-MRXNPFEDSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)