Products 1242339-29-2

CAS 1242339-29-2 is the registry number for Methyl 3-[1-benzyl-4-(dimethylamino)piperidin-3-yl]propanoate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-[1-benzyl-4-(dimethylamino)piperidin-3-yl]propanoate;oxalic acid (CAS 1242339-29-2) is a chemical compound with the molecular formula C20H30N2O6 and a molecular weight of 394.5 g/mol. IUPAC name: methyl 3-[1-benzyl-4-(dimethylamino)piperidin-3-yl]propanoate;oxalic acid. InChIKey: IQBRODHFIQRMIP-UHFFFAOYSA-N.

Identity
Molecular formulaC20H30N2O6
Molecular weight394.5 g/mol
IUPAC namemethyl 3-[1-benzyl-4-(dimethylamino)piperidin-3-yl]propanoate;oxalic acid
InChIKeyIQBRODHFIQRMIP-UHFFFAOYSA-N
SMILESCN(C)C1CCN(CC1CCC(=O)OC)CC2=CC=CC=C2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)