cas: 64030-44-0 — see every product listed under this CAS number, including other names
(S)-N-(Pyrrolidin-2-ylmethyl)aniline 98% (CAS 64030-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A619014-100mg |
| cas | 64030-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1983.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A619014 |
N-[[(2S)-pyrrolidin-2-yl]methyl]aniline (CAS 64030-44-0) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: N-[[(2S)-pyrrolidin-2-yl]methyl]aniline. InChIKey: MCHWKJRTMPIHRA-NSHDSACASA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | N-[[(2S)-pyrrolidin-2-yl]methyl]aniline |
| InChIKey | MCHWKJRTMPIHRA-NSHDSACASA-N |
| SMILES | C1C[C@H](NC1)CNC2=CC=CC=C2 |
Computed by PubChem (NCBI)