cas: 199005-69-1 — see every product listed under this CAS number, including other names
(S)-Na-Z-Nb-Boc-2,3-diaminopropan-1-ol, 95% (CAS 199005-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493572-250MG |
| cas | 199005-69-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 1g | 2189.87 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-[(2S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate (CAS 199005-69-1) is a chemical compound with the molecular formula C16H24N2O5 and a molecular weight of 324.37 g/mol. IUPAC name: benzyl N-[(2S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate. InChIKey: ZRYGVUNFLKWGQH-ZDUSSCGKSA-N.
| Molecular formula | C16H24N2O5 |
|---|---|
| Molecular weight | 324.37 g/mol |
| IUPAC name | benzyl N-[(2S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate |
| InChIKey | ZRYGVUNFLKWGQH-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)