CAS 1081824-15-8 is the registry number for 2-(Diethylamino)ethyl 4-nitro-2-propoxybenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(diethylamino)ethyl 4-nitro-2-propoxybenzoate (CAS 1081824-15-8) is a chemical compound with the molecular formula C16H24N2O5 and a molecular weight of 324.37 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-nitro-2-propoxybenzoate. InChIKey: AYZMJXVIPUQYLS-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O5 |
|---|---|
| Molecular weight | 324.37 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-nitro-2-propoxybenzoate |
| InChIKey | AYZMJXVIPUQYLS-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)OCCN(CC)CC |
Computed by PubChem (NCBI)