(S)-Oxetan-2-ylmethanamine (2S,3S)-2,3-dihydroxysuccinate, 95% （hydrate）
cas: 2740593-21-7 — see every product listed under this CAS number, including other names
(S)-Oxetan-2-ylmethanamine (2S,3S)-2,3-dihydroxysuccinate, 95% （hydrate） (CAS 2740593-21-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2921818-1g |
| cas | 2740593-21-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 765.31 Pln | |
| Ambeed | 10g | 1160.25 Pln | |
| Ambeed | 25g | 1939.00 Pln | |
| Ambeed | 100g | 5359.94 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 819.74 Pln | |
| BLDpharm | 10g | 1247.36 Pln | |
| BLDpharm | 25g | 2085.96 Pln | |
| BLDpharm | 100g | 5773.55 Pln |
properties
| purity | 95% （hydrate） |
|---|---|
| delivery time | 2-3 weeks |
(2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine (CAS 2740593-21-7) is a chemical compound with the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine. InChIKey: SHXODAKWLCNLOY-LGTQNKHISA-N.
| Molecular formula | C8H15NO7 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine |
| InChIKey | SHXODAKWLCNLOY-LGTQNKHISA-N |
| SMILES | C1CO[C@@H]1CN.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)