CAS 2740593-21-7 is the registry number for (S)-Oxetan-2-ylmethanamine (2S,3S)-2,3-dihydroxysuccinate, 95% (hydrate). Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine (CAS 2740593-21-7) is a chemical compound with the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine. InChIKey: SHXODAKWLCNLOY-LGTQNKHISA-N.
| Molecular formula | C8H15NO7 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine |
| InChIKey | SHXODAKWLCNLOY-LGTQNKHISA-N |
| SMILES | C1CO[C@@H]1CN.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)