Products 2740593-21-7

CAS 2740593-21-7 is the registry number for (S)-Oxetan-2-ylmethanamine (2S,3S)-2,3-dihydroxysuccinate, 95% (hydrate). Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

(2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine (CAS 2740593-21-7) is a chemical compound with the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine. InChIKey: SHXODAKWLCNLOY-LGTQNKHISA-N.

Identity
Molecular formulaC8H15NO7
Molecular weight237.21 g/mol
IUPAC name(2S,3S)-2,3-dihydroxybutanedioic acid;[(2S)-oxetan-2-yl]methanamine
InChIKeySHXODAKWLCNLOY-LGTQNKHISA-N
SMILESC1CO[C@@H]1CN.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O

Computed by PubChem (NCBI)