CAS 60644-20-4 appears in our catalog under these names: Fructosyl Glycine Alpha/Beta Mixture (Mixture of Diastereomers), >95% (HPLC), Fructosyl Glycine α/β Mixture (Mixture of Diastereomers), 1-Deoxyfructosyl-Gly, Fructosyl Glycine a/b Mixture (Mixture of Diastereomers), ≥95%, ≥95%. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 1mg.
2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]acetic acid (CAS 60644-20-4) is a chemical compound with the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. IUPAC name: 2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]acetic acid. InChIKey: BVWXBDYZZFSXIL-CCXZUQQUSA-N.
| Molecular formula | C8H15NO7 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]acetic acid |
| InChIKey | BVWXBDYZZFSXIL-CCXZUQQUSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@](O1)(CNCC(=O)O)O)O)O)O |
Computed by PubChem (NCBI)