cas: 24302-67-8 — see every product listed under this CAS number, including other names
(S)-Quinolin-4-yl((1S,2R,4S,5R)-5-vinylquinuclidin-2-yl)methanol Xhydrochloride (CAS 24302-67-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OWM-1g |
| cas | 24302-67-8 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 25g | 602.00 Pln | |
| Chemat | 100g | 2162.00 Pln |
| delivery time | 3 weeks |
|---|
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride (CAS 24302-67-8) is a chemical compound with the molecular formula C19H23ClN2O and a molecular weight of 330.8 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride. InChIKey: IMUHWLVEEVGMBC-BKUXTCEESA-N.
| Molecular formula | C19H23ClN2O |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride |
| InChIKey | IMUHWLVEEVGMBC-BKUXTCEESA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.Cl |
Computed by PubChem (NCBI)