CAS 5949-11-1 appears in our catalog under these names: Cinchonine hydrochloride, Cinchonine Hydrochloride Hydrate, Cinchonium hydrochloride, ≥80%, ≥80%, Cinchonine (hydrochloride). Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 20mg, 10g, 5g, 25g, Get quote.
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride (CAS 5949-11-1) is a chemical compound with the molecular formula C19H23ClN2O and a molecular weight of 330.8 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride. InChIKey: IMUHWLVEEVGMBC-BKUXTCEESA-N.
| Molecular formula | C19H23ClN2O |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrochloride |
| InChIKey | IMUHWLVEEVGMBC-BKUXTCEESA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.Cl |
Computed by PubChem (NCBI)