cas: 944470-56-8 — see every product listed under this CAS number, including other names
(S)-TERT-BUTYL (1-(3-FLUOROPHENYL)-3-HYDROXYPROPAN-2-YL)CARBAMATE, 97% (CAS 944470-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513184-100MG |
| cas | 944470-56-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 1g | 1934.75 Pln | |
| Fluorochem | 5g | 7792.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate (CAS 944470-56-8) is a chemical compound with the molecular formula C14H20FNO3 and a molecular weight of 269.31 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate. InChIKey: HFOFNJNYQFXYDX-LBPRGKRZSA-N.
| Molecular formula | C14H20FNO3 |
|---|---|
| Molecular weight | 269.31 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate |
| InChIKey | HFOFNJNYQFXYDX-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)F)CO |
Computed by PubChem (NCBI)