cas: 944470-56-8 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (1-(3-fluorophenyl)-3-hydroxypropan-2-yl)carbamate, 95%, 95% (CAS 944470-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II7F-100mg |
| cas | 944470-56-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1888.40 Pln | |
| Chemat | 500mg | 1158.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate (CAS 944470-56-8) is a chemical compound with the molecular formula C14H20FNO3 and a molecular weight of 269.31 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate. InChIKey: HFOFNJNYQFXYDX-LBPRGKRZSA-N.
| Molecular formula | C14H20FNO3 |
|---|---|
| Molecular weight | 269.31 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(3-fluorophenyl)-3-hydroxypropan-2-yl]carbamate |
| InChIKey | HFOFNJNYQFXYDX-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)F)CO |
Computed by PubChem (NCBI)