cas: 1973408-97-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)carbamate, 95% (CAS 1973408-97-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1246261-1g |
| cas | 1973408-97-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 665.19 Pln | |
| Ambeed | 5g | 1249.25 Pln | |
| Ambeed | 10g | 1838.88 Pln | |
| Ambeed | 25g | 3602.19 Pln | |
| BLDpharm | 1g | 708.66 Pln | |
| BLDpharm | 5g | 1341.77 Pln | |
| BLDpharm | 10g | 1974.88 Pln | |
| BLDpharm | 25g | 3874.22 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1082.00 Pln | |
| Chemat | 10g | 1590.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate (CAS 1973408-97-7) is a chemical compound with the molecular formula C17H22N2O2S and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate. InChIKey: RJJHLQJCHIINDW-NSHDSACASA-N.
| Molecular formula | C17H22N2O2S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate |
| InChIKey | RJJHLQJCHIINDW-NSHDSACASA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)