Products 1210129-71-7

CAS 1210129-71-7 is the registry number for Ethyl 2-(4-(2,6-diethylphenylamino)-3,5-thiazolyl)acetate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetate (CAS 1210129-71-7) is a chemical compound with the molecular formula C17H22N2O2S and a molecular weight of 318.4 g/mol. IUPAC name: ethyl 2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetate. InChIKey: ZDCGSZGCPWBINN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22N2O2S
Molecular weight318.4 g/mol
IUPAC nameethyl 2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetate
InChIKeyZDCGSZGCPWBINN-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC=C1)CC)NC2=NC(=CS2)CC(=O)OCC

Computed by PubChem (NCBI)