CAS 2521020-27-7 is the registry number for tert-Butyl (R)-(1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate (CAS 2521020-27-7) is a chemical compound with the molecular formula C17H22N2O2S and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl N-[(1R)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate. InChIKey: RJJHLQJCHIINDW-LLVKDONJSA-N.
| Molecular formula | C17H22N2O2S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate |
| InChIKey | RJJHLQJCHIINDW-LLVKDONJSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)[C@@H](C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)